C29H36N6O2S2 — CID 149441219
N-[3-[2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]thieno[3,2-d]pyrimidin-7-yl]phenyl]-2-methylpropane-2-sulfonamide (PubChem CID 149441219) has the molecular formula C29H36N6O2S2 and a molecular weight of 564.78 g/mol. Its IUPAC name is N-[3-[2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]thieno[3,2-d]pyrimidin-7-yl]phenyl]-2-methylpropane-2-sulfonamide.
| Compound Name | N-[3-[2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]thieno[3,2-d]pyrimidin-7-yl]phenyl]-2-methylpropane-2-sulfonamide |
|---|---|
| PubChem CID | 149441219 |
| Molecular Formula | C29H36N6O2S2 |
| Molecular Weight | 564.78 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | N-[3-[2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]thieno[3,2-d]pyrimidin-7-yl]phenyl]-2-methylpropane-2-sulfonamide |
| SMILES | CN(C)C1CCN(c2ccc(Nc3ncc4scc(-c5cccc(NS(=O)(=O)C(C)(C)C)c5)c4n3)cc2)CC1 |
| InChI | InChI=1S/C29H36N6O2S2/c1-29(2,3)39(36,37)33-22-8-6-7-20(17-22)25-19-38-26-18-30-28(32-27(25)26)31-21-9-11-24(12-10-21)35-15-13-23(14-16-35)34(4)5/h6-12,17-19,23,33H,13-16H2,1-5H3,(H,30,31,32) |
| InChIKey | YVUDVSAPXKJGSI-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.78 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|