C10H17N — CID 14944176
(2S,5R)-2,5-bis(prop-2-enyl)pyrrolidine (PubChem CID 14944176) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is (2S,5R)-2,5-bis(prop-2-enyl)pyrrolidine.
| Compound Name | (2S,5R)-2,5-bis(prop-2-enyl)pyrrolidine |
|---|---|
| PubChem CID | 14944176 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | (2S,5R)-2,5-bis(prop-2-enyl)pyrrolidine |
| SMILES | C=CC[C@@H]1CC[C@H](CC=C)N1 |
| InChI | InChI=1S/C10H17N/c1-3-5-9-7-8-10(11-9)6-4-2/h3-4,9-11H,1-2,5-8H2/t9-,10+ |
| InChIKey | LCDOLDOXPNSUAT-AOOOYVTPSA-N |
| XLogP | 2.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|