About 1-(2-chloroethyl)-3-(2,2-dimethyl-5-propan-2-yl-1,3-dioxan-5-yl)urea
1-(2-chloroethyl)-3-(2,2-dimethyl-5-propan-2-yl-1,3-dioxan-5-yl)urea (PubChem CID 14944799) has the molecular formula C12H23ClN2O3
and a molecular weight of 278.78 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-(2,2-dimethyl-5-propan-2-yl-1,3-dioxan-5-yl)urea.
Molecular Properties
| Compound Name | 1-(2-chloroethyl)-3-(2,2-dimethyl-5-propan-2-yl-1,3-dioxan-5-yl)urea |
| PubChem CID | 14944799 |
| Molecular Formula | C12H23ClN2O3 |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 1-(2-chloroethyl)-3-(2,2-dimethyl-5-propan-2-yl-1,3-dioxan-5-yl)urea |
| SMILES | CC(C)C1(NC(=O)NCCCl)COC(C)(C)OC1 |
| InChI | InChI=1S/C12H23ClN2O3/c1-9(2)12(15-10(16)14-6-5-13)7-17-11(3,4)18-8-12/h9H,5-8H2,1-4H3,(H2,14,15,16) |
| InChIKey | YNBQLGGSMXUITI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-chloroethyl)-3-(2,2-dimethyl-5-propan-2-yl-1,3-dioxan-5-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chloroethyl)-3-(2,2-dimethyl-5-propan-2-yl-1,3-dioxan-5-yl)urea?
The IUPAC name of 1-(2-chloroethyl)-3-(2,2-dimethyl-5-propan-2-yl-1,3-dioxan-5-yl)urea (CID 14944799) is 1-(2-chloroethyl)-3-(2,2-dimethyl-5-propan-2-yl-1,3-dioxan-5-yl)urea.
What is the SMILES notation for 1-(2-chloroethyl)-3-(2,2-dimethyl-5-propan-2-yl-1,3-dioxan-5-yl)urea?
The canonical SMILES for 1-(2-chloroethyl)-3-(2,2-dimethyl-5-propan-2-yl-1,3-dioxan-5-yl)urea is CC(C)C1(NC(=O)NCCCl)COC(C)(C)OC1.
What is the InChIKey of 1-(2-chloroethyl)-3-(2,2-dimethyl-5-propan-2-yl-1,3-dioxan-5-yl)urea?
The InChIKey is YNBQLGGSMXUITI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23ClN2O3/c1-9(2)12(15-10(16)14-6-5-13)7-17-11(3,4)18-8-12/h9H,5-8H2,1-4H3,(H2,14,15,16).
What are the key properties of 1-(2-chloroethyl)-3-(2,2-dimethyl-5-propan-2-yl-1,3-dioxan-5-yl)urea?
1-(2-chloroethyl)-3-(2,2-dimethyl-5-propan-2-yl-1,3-dioxan-5-yl)urea has a molecular weight of 278.78 g/mol, XLogP of 1.70, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chloroethyl)-3-(2,2-dimethyl-5-propan-2-yl-1,3-dioxan-5-yl)urea is sourced from PubChem (CID 14944799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).