C10H18ClN3O4 — CID 14944802
1-(2-chloroethyl)-1-nitroso-3-(2,2,5-trimethyl-1,3-dioxan-5-yl)urea (PubChem CID 14944802) has the molecular formula C10H18ClN3O4 and a molecular weight of 279.72 g/mol. Its IUPAC name is 1-(2-chloroethyl)-1-nitroso-3-(2,2,5-trimethyl-1,3-dioxan-5-yl)urea.
| Compound Name | 1-(2-chloroethyl)-1-nitroso-3-(2,2,5-trimethyl-1,3-dioxan-5-yl)urea |
|---|---|
| PubChem CID | 14944802 |
| Molecular Formula | C10H18ClN3O4 |
| Molecular Weight | 279.72 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 1-(2-chloroethyl)-1-nitroso-3-(2,2,5-trimethyl-1,3-dioxan-5-yl)urea |
| SMILES | CC1(NC(=O)N(CCCl)N=O)COC(C)(C)OC1 |
| InChI | InChI=1S/C10H18ClN3O4/c1-9(2)17-6-10(3,7-18-9)12-8(15)14(13-16)5-4-11/h4-7H2,1-3H3,(H,12,15) |
| InChIKey | IQBJKRXINJUAIW-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.72 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|