About 1-(2-chloroethyl)-3-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-1-nitrosourea
1-(2-chloroethyl)-3-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-1-nitrosourea (PubChem CID 14944804) has the molecular formula C10H18ClN3O5
and a molecular weight of 295.72 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-1-nitrosourea.
Molecular Properties
| Compound Name | 1-(2-chloroethyl)-3-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-1-nitrosourea |
| PubChem CID | 14944804 |
| Molecular Formula | C10H18ClN3O5 |
| Molecular Weight | 295.72 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 1-(2-chloroethyl)-3-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-1-nitrosourea |
| SMILES | CC1(C)OCC(CO)(NC(=O)N(CCCl)N=O)CO1 |
| InChI | InChI=1S/C10H18ClN3O5/c1-9(2)18-6-10(5-15,7-19-9)12-8(16)14(13-17)4-3-11/h15H,3-7H2,1-2H3,(H,12,16) |
| InChIKey | QZARTEFVBKZXBH-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.72 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-chloroethyl)-3-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-1-nitrosourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chloroethyl)-3-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-1-nitrosourea?
The IUPAC name of 1-(2-chloroethyl)-3-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-1-nitrosourea (CID 14944804) is 1-(2-chloroethyl)-3-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-1-nitrosourea.
What is the SMILES notation for 1-(2-chloroethyl)-3-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-1-nitrosourea?
The canonical SMILES for 1-(2-chloroethyl)-3-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-1-nitrosourea is CC1(C)OCC(CO)(NC(=O)N(CCCl)N=O)CO1.
What is the InChIKey of 1-(2-chloroethyl)-3-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-1-nitrosourea?
The InChIKey is QZARTEFVBKZXBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18ClN3O5/c1-9(2)18-6-10(5-15,7-19-9)12-8(16)14(13-17)4-3-11/h15H,3-7H2,1-2H3,(H,12,16).
What are the key properties of 1-(2-chloroethyl)-3-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-1-nitrosourea?
1-(2-chloroethyl)-3-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-1-nitrosourea has a molecular weight of 295.72 g/mol, XLogP of 0.43, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chloroethyl)-3-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxan-5-yl]-1-nitrosourea is sourced from PubChem (CID 14944804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).