C7H13N3O — CID 149448490
3-(ethylamino)-1-hydroxypyrrolidine-3-carbonitrile (PubChem CID 149448490) has the molecular formula C7H13N3O and a molecular weight of 155.20 g/mol. Its IUPAC name is 3-(ethylamino)-1-hydroxypyrrolidine-3-carbonitrile.
| Compound Name | 3-(ethylamino)-1-hydroxypyrrolidine-3-carbonitrile |
|---|---|
| PubChem CID | 149448490 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 3-(ethylamino)-1-hydroxypyrrolidine-3-carbonitrile |
| SMILES | CCNC1(C#N)CCN(O)C1 |
| InChI | InChI=1S/C7H13N3O/c1-2-9-7(5-8)3-4-10(11)6-7/h9,11H,2-4,6H2,1H3 |
| InChIKey | YXDPHVOIPYVELC-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |