C14H21NO2 — CID 149451120
benzyl 3-(aminomethyl)-5,5,5-trideuterio-3-methylpentanoate (PubChem CID 149451120) has the molecular formula C14H21NO2 and a molecular weight of 238.35 g/mol. Its IUPAC name is benzyl 3-(aminomethyl)-5,5,5-trideuterio-3-methylpentanoate.
| Compound Name | benzyl 3-(aminomethyl)-5,5,5-trideuterio-3-methylpentanoate |
|---|---|
| PubChem CID | 149451120 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | benzyl 3-(aminomethyl)-5,5,5-trideuterio-3-methylpentanoate |
| SMILES | [2H]C([2H])([2H])CC(C)(CN)CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H21NO2/c1-3-14(2,11-15)9-13(16)17-10-12-7-5-4-6-8-12/h4-8H,3,9-11,15H2,1-2H3/i1D3 |
| InChIKey | YXQSMMOYEGMBEC-FIBGUPNXSA-N |
| XLogP | 2.49 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |