C22H22IN3O — CID 149452538
(1S)-N-[[1-[5-(2-iodophenyl)-1,2,4-oxadiazol-3-yl]cyclobutyl]methyl]-2-phenylcyclopropan-1-amine (PubChem CID 149452538) has the molecular formula C22H22IN3O and a molecular weight of 471.34 g/mol. Its IUPAC name is (1S)-N-[[1-[5-(2-iodophenyl)-1,2,4-oxadiazol-3-yl]cyclobutyl]methyl]-2-phenylcyclopropan-1-amine.
| Compound Name | (1S)-N-[[1-[5-(2-iodophenyl)-1,2,4-oxadiazol-3-yl]cyclobutyl]methyl]-2-phenylcyclopropan-1-amine |
|---|---|
| PubChem CID | 149452538 |
| Molecular Formula | C22H22IN3O |
| Molecular Weight | 471.34 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | (1S)-N-[[1-[5-(2-iodophenyl)-1,2,4-oxadiazol-3-yl]cyclobutyl]methyl]-2-phenylcyclopropan-1-amine |
| SMILES | Ic1ccccc1-c1nc(C2(CN[C@H]3CC3c3ccccc3)CCC2)no1 |
| InChI | InChI=1S/C22H22IN3O/c23-18-10-5-4-9-16(18)20-25-21(26-27-20)22(11-6-12-22)14-24-19-13-17(19)15-7-2-1-3-8-15/h1-5,7-10,17,19,24H,6,11-14H2/t17?,19-/m0/s1 |
| InChIKey | YXXSSTMVVBDQLD-NNBQYGFHSA-N |
| XLogP | 4.91 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.34 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|