C11H15IO2 — CID 14945366
(4aR,4bR,8aS,9aS)-7-iodo-3,4,4a,4b,5,8,8a,9a-octahydro-2H-pyrano[2,3-b][1]benzofuran (PubChem CID 14945366) has the molecular formula C11H15IO2 and a molecular weight of 306.14 g/mol. Its IUPAC name is (4aR,4bR,8aS,9aS)-7-iodo-3,4,4a,4b,5,8,8a,9a-octahydro-2H-pyrano[2,3-b][1]benzofuran.
| Compound Name | (4aR,4bR,8aS,9aS)-7-iodo-3,4,4a,4b,5,8,8a,9a-octahydro-2H-pyrano[2,3-b][1]benzofuran |
|---|---|
| PubChem CID | 14945366 |
| Molecular Formula | C11H15IO2 |
| Molecular Weight | 306.14 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | (4aR,4bR,8aS,9aS)-7-iodo-3,4,4a,4b,5,8,8a,9a-octahydro-2H-pyrano[2,3-b][1]benzofuran |
| SMILES | IC1=CC[C@@H]2[C@H]3CCCO[C@H]3O[C@H]2C1 |
| InChI | InChI=1S/C11H15IO2/c12-7-3-4-8-9-2-1-5-13-11(9)14-10(8)6-7/h3,8-11H,1-2,4-6H2/t8-,9-,10+,11+/m1/s1 |
| InChIKey | UFKKLGMYNHQTIS-ZNSHCXBVSA-N |
| XLogP | 2.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.14 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|