About [(E)-6-chloro-2-methylhex-4-en-3-yl] prop-2-ynoate
[(E)-6-chloro-2-methylhex-4-en-3-yl] prop-2-ynoate (PubChem CID 14945386) has the molecular formula C10H13ClO2
and a molecular weight of 200.66 g/mol. Its IUPAC name is [(E)-6-chloro-2-methylhex-4-en-3-yl] prop-2-ynoate.
Molecular Properties
| Compound Name | [(E)-6-chloro-2-methylhex-4-en-3-yl] prop-2-ynoate |
| PubChem CID | 14945386 |
| Molecular Formula | C10H13ClO2 |
| Molecular Weight | 200.66 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | [(E)-6-chloro-2-methylhex-4-en-3-yl] prop-2-ynoate |
| SMILES | C#CC(=O)OC(/C=C/CCl)C(C)C |
| InChI | InChI=1S/C10H13ClO2/c1-4-10(12)13-9(8(2)3)6-5-7-11/h1,5-6,8-9H,7H2,2-3H3/b6-5+ |
| InChIKey | SSNADXZHYAPVHU-AATRIKPKSA-N |
| XLogP | 1.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.66 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(E)-6-chloro-2-methylhex-4-en-3-yl] prop-2-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-6-chloro-2-methylhex-4-en-3-yl] prop-2-ynoate?
The IUPAC name of [(E)-6-chloro-2-methylhex-4-en-3-yl] prop-2-ynoate (CID 14945386) is [(E)-6-chloro-2-methylhex-4-en-3-yl] prop-2-ynoate.
What is the SMILES notation for [(E)-6-chloro-2-methylhex-4-en-3-yl] prop-2-ynoate?
The canonical SMILES for [(E)-6-chloro-2-methylhex-4-en-3-yl] prop-2-ynoate is C#CC(=O)OC(/C=C/CCl)C(C)C.
What is the InChIKey of [(E)-6-chloro-2-methylhex-4-en-3-yl] prop-2-ynoate?
The InChIKey is SSNADXZHYAPVHU-AATRIKPKSA-N. The full InChI is InChI=1S/C10H13ClO2/c1-4-10(12)13-9(8(2)3)6-5-7-11/h1,5-6,8-9H,7H2,2-3H3/b6-5+.
What are the key properties of [(E)-6-chloro-2-methylhex-4-en-3-yl] prop-2-ynoate?
[(E)-6-chloro-2-methylhex-4-en-3-yl] prop-2-ynoate has a molecular weight of 200.66 g/mol, XLogP of 1.98, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-6-chloro-2-methylhex-4-en-3-yl] prop-2-ynoate is sourced from PubChem (CID 14945386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).