C27H40N2O3Si — CID 14945794
[(1S)-2-(dibenzylamino)-1-trimethylsilylethyl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 14945794) has the molecular formula C27H40N2O3Si and a molecular weight of 468.71 g/mol. Its IUPAC name is [(1S)-2-(dibenzylamino)-1-trimethylsilylethyl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | [(1S)-2-(dibenzylamino)-1-trimethylsilylethyl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 14945794 |
| Molecular Formula | C27H40N2O3Si |
| Molecular Weight | 468.71 g/mol |
| Exact Mass | 468.28 |
| IUPAC Name | [(1S)-2-(dibenzylamino)-1-trimethylsilylethyl] 2,2,4,4-tetramethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC1(C)COC(C)(C)N1C(=O)O[C@H](CN(Cc1ccccc1)Cc1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C27H40N2O3Si/c1-26(2)21-31-27(3,4)29(26)25(30)32-24(33(5,6)7)20-28(18-22-14-10-8-11-15-22)19-23-16-12-9-13-17-23/h8-17,24H,18-21H2,1-7H3/t24-/m0/s1 |
| InChIKey | XONULHZRKPHWEZ-DEOSSOPVSA-N |
| XLogP | 5.92 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.71 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|