C19H23N5O2S — CID 149458185
N-[[(3R,4S)-3-ethyl-4-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclopentyl]methylidene]cyclopropanesulfonamide (PubChem CID 149458185) has the molecular formula C19H23N5O2S and a molecular weight of 385.49 g/mol. Its IUPAC name is N-[[(3R,4S)-3-ethyl-4-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclopentyl]methylidene]cyclopropanesulfonamide.
| Compound Name | N-[[(3R,4S)-3-ethyl-4-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclopentyl]methylidene]cyclopropanesulfonamide |
|---|---|
| PubChem CID | 149458185 |
| Molecular Formula | C19H23N5O2S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | N-[[(3R,4S)-3-ethyl-4-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)cyclopentyl]methylidene]cyclopropanesulfonamide |
| SMILES | CC[C@@H]1CC(C=NS(=O)(=O)C2CC2)C[C@@H]1n1cnc2cnc3[nH]ccc3c21 |
| InChI | InChI=1S/C19H23N5O2S/c1-2-13-7-12(9-23-27(25,26)14-3-4-14)8-17(13)24-11-22-16-10-21-19-15(18(16)24)5-6-20-19/h5-6,9-14,17H,2-4,7-8H2,1H3,(H,20,21)/t12?,13-,17+/m1/s1 |
| InChIKey | YYZGSMJFBRKYLV-SHSDOYLRSA-N |
| XLogP | 3.45 |
| TPSA | 93.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|