C15H18N4O3 — CID 149458434
5-(3,4-diaminophenyl)-N-[(2S)-1-(methylamino)-1-oxopropan-2-yl]furan-2-carboxamide (PubChem CID 149458434) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is 5-(3,4-diaminophenyl)-N-[(2S)-1-(methylamino)-1-oxopropan-2-yl]furan-2-carboxamide.
| Compound Name | 5-(3,4-diaminophenyl)-N-[(2S)-1-(methylamino)-1-oxopropan-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 149458434 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 5-(3,4-diaminophenyl)-N-[(2S)-1-(methylamino)-1-oxopropan-2-yl]furan-2-carboxamide |
| SMILES | CNC(=O)[C@H](C)NC(=O)c1ccc(-c2ccc(N)c(N)c2)o1 |
| InChI | InChI=1S/C15H18N4O3/c1-8(14(20)18-2)19-15(21)13-6-5-12(22-13)9-3-4-10(16)11(17)7-9/h3-8H,16-17H2,1-2H3,(H,18,20)(H,19,21)/t8-/m0/s1 |
| InChIKey | YZAMLHDVIUUDBN-QMMMGPOBSA-N |
| XLogP | 0.98 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|