C21H18ClF6N3O4S — CID 149460282
methyl 5-chloro-1-[2-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]acetyl]spiro[2H-indole-3,3'-pyrrolidine]-1'-carboxylate (PubChem CID 149460282) has the molecular formula C21H18ClF6N3O4S and a molecular weight of 557.90 g/mol. Its IUPAC name is methyl 5-chloro-1-[2-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]acetyl]spiro[2H-indole-3,3'-pyrrolidine]-1'-carboxylate.
| Compound Name | methyl 5-chloro-1-[2-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]acetyl]spiro[2H-indole-3,3'-pyrrolidine]-1'-carboxylate |
|---|---|
| PubChem CID | 149460282 |
| Molecular Formula | C21H18ClF6N3O4S |
| Molecular Weight | 557.90 g/mol |
| Exact Mass | 557.06 |
| IUPAC Name | methyl 5-chloro-1-[2-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1,3-thiazol-2-yl]acetyl]spiro[2H-indole-3,3'-pyrrolidine]-1'-carboxylate |
| SMILES | COC(=O)N1CCC2(C1)CN(C(=O)Cc1ncc(C(O)(C(F)(F)F)C(F)(F)F)s1)c1ccc(Cl)cc12 |
| InChI | InChI=1S/C21H18ClF6N3O4S/c1-35-17(33)30-5-4-18(9-30)10-31(13-3-2-11(22)6-12(13)18)16(32)7-15-29-8-14(36-15)19(34,20(23,24)25)21(26,27)28/h2-3,6,8,34H,4-5,7,9-10H2,1H3 |
| InChIKey | YZJHCWCNRRTTME-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.90 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |