C10H10N2S — CID 14946039
(1S,6R,7R,8R)-9-thiabicyclo[4.2.1]non-3-ene-7,8-dicarbonitrile (PubChem CID 14946039) has the molecular formula C10H10N2S and a molecular weight of 190.27 g/mol. Its IUPAC name is (1S,6R,7R,8R)-9-thiabicyclo[4.2.1]non-3-ene-7,8-dicarbonitrile.
| Compound Name | (1S,6R,7R,8R)-9-thiabicyclo[4.2.1]non-3-ene-7,8-dicarbonitrile |
|---|---|
| PubChem CID | 14946039 |
| Molecular Formula | C10H10N2S |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | (1S,6R,7R,8R)-9-thiabicyclo[4.2.1]non-3-ene-7,8-dicarbonitrile |
| SMILES | N#C[C@H]1[C@H](C#N)[C@H]2CC=CC[C@@H]1S2 |
| InChI | InChI=1S/C10H10N2S/c11-5-7-8(6-12)10-4-2-1-3-9(7)13-10/h1-2,7-10H,3-4H2/t7-,8-,9-,10+/m0/s1 |
| InChIKey | JCEZMUAEOWLRRP-AATLWQCWSA-N |
| XLogP | 2.10 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|