C12H14O — CID 14946137
(1R,6S)-8-methylbicyclo[4.4.1]undeca-2,4,8-trien-11-one (PubChem CID 14946137) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is (1R,6S)-8-methylbicyclo[4.4.1]undeca-2,4,8-trien-11-one.
| Compound Name | (1R,6S)-8-methylbicyclo[4.4.1]undeca-2,4,8-trien-11-one |
|---|---|
| PubChem CID | 14946137 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | (1R,6S)-8-methylbicyclo[4.4.1]undeca-2,4,8-trien-11-one |
| SMILES | CC1=CC[C@@H]2C=CC=C[C@H](C1)C2=O |
| InChI | InChI=1S/C12H14O/c1-9-6-7-10-4-2-3-5-11(8-9)12(10)13/h2-6,10-11H,7-8H2,1H3/t10-,11+/m0/s1 |
| InChIKey | GGMWSDFWRUXWON-WDEREUQCSA-N |
| XLogP | 2.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|