C29H29ClFN3O2 — CID 149464934
1-(7-chloro-2-ethylimidazo[1,2-a]pyridin-3-yl)-3-[4-[4-(4-fluorophenyl)-4-hydroxypiperidin-1-yl]phenyl]propan-1-one (PubChem CID 149464934) has the molecular formula C29H29ClFN3O2 and a molecular weight of 506.02 g/mol. Its IUPAC name is 1-(7-chloro-2-ethylimidazo[1,2-a]pyridin-3-yl)-3-[4-[4-(4-fluorophenyl)-4-hydroxypiperidin-1-yl]phenyl]propan-1-one.
| Compound Name | 1-(7-chloro-2-ethylimidazo[1,2-a]pyridin-3-yl)-3-[4-[4-(4-fluorophenyl)-4-hydroxypiperidin-1-yl]phenyl]propan-1-one |
|---|---|
| PubChem CID | 149464934 |
| Molecular Formula | C29H29ClFN3O2 |
| Molecular Weight | 506.02 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | 1-(7-chloro-2-ethylimidazo[1,2-a]pyridin-3-yl)-3-[4-[4-(4-fluorophenyl)-4-hydroxypiperidin-1-yl]phenyl]propan-1-one |
| SMILES | CCc1nc2cc(Cl)ccn2c1C(=O)CCc1ccc(N2CCC(O)(c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C29H29ClFN3O2/c1-2-25-28(34-16-13-22(30)19-27(34)32-25)26(35)12-5-20-3-10-24(11-4-20)33-17-14-29(36,15-18-33)21-6-8-23(31)9-7-21/h3-4,6-11,13,16,19,36H,2,5,12,14-15,17-18H2,1H3 |
| InChIKey | ZAFTWVLBFRDKNZ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.02 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|