C25H18F2NO+ — CID 149466397
2-(7,9-difluoro-3-methyl-6-phenyldibenzofuran-4-yl)-1-methylpyridin-1-ium (PubChem CID 149466397) has the molecular formula C25H18F2NO+ and a molecular weight of 386.42 g/mol. Its IUPAC name is 2-(7,9-difluoro-3-methyl-6-phenyldibenzofuran-4-yl)-1-methylpyridin-1-ium.
| Compound Name | 2-(7,9-difluoro-3-methyl-6-phenyldibenzofuran-4-yl)-1-methylpyridin-1-ium |
|---|---|
| PubChem CID | 149466397 |
| Molecular Formula | C25H18F2NO+ |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 2-(7,9-difluoro-3-methyl-6-phenyldibenzofuran-4-yl)-1-methylpyridin-1-ium |
| SMILES | Cc1ccc2c(oc3c(-c4ccccc4)c(F)cc(F)c32)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C25H18F2NO/c1-15-11-12-17-23-19(27)14-18(26)22(16-8-4-3-5-9-16)25(23)29-24(17)21(15)20-10-6-7-13-28(20)2/h3-14H,1-2H3/q+1 |
| InChIKey | PJISULDTEVSSDA-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 17.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|