C12H13NO — CID 149469619
7-methyl-1,4,5,9b-tetrahydroazirino[2,1-a][2]benzazepin-3-one (PubChem CID 149469619) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is 7-methyl-1,4,5,9b-tetrahydroazirino[2,1-a][2]benzazepin-3-one.
| Compound Name | 7-methyl-1,4,5,9b-tetrahydroazirino[2,1-a][2]benzazepin-3-one |
|---|---|
| PubChem CID | 149469619 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 7-methyl-1,4,5,9b-tetrahydroazirino[2,1-a][2]benzazepin-3-one |
| SMILES | Cc1ccc2c(c1)CCC(=O)N1CC21 |
| InChI | InChI=1S/C12H13NO/c1-8-2-4-10-9(6-8)3-5-12(14)13-7-11(10)13/h2,4,6,11H,3,5,7H2,1H3 |
| InChIKey | ZBCPBRZJFZDBFM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 20.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|