C24H25F3N2 — CID 149469691
4-(4-benzyl-2H-pyrrol-3-yl)-1-[[4-(trifluoromethyl)phenyl]methyl]piperidine (PubChem CID 149469691) has the molecular formula C24H25F3N2 and a molecular weight of 398.47 g/mol. Its IUPAC name is 4-(4-benzyl-2H-pyrrol-3-yl)-1-[[4-(trifluoromethyl)phenyl]methyl]piperidine.
| Compound Name | 4-(4-benzyl-2H-pyrrol-3-yl)-1-[[4-(trifluoromethyl)phenyl]methyl]piperidine |
|---|---|
| PubChem CID | 149469691 |
| Molecular Formula | C24H25F3N2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 4-(4-benzyl-2H-pyrrol-3-yl)-1-[[4-(trifluoromethyl)phenyl]methyl]piperidine |
| SMILES | FC(F)(F)c1ccc(CN2CCC(C3=C(Cc4ccccc4)C=NC3)CC2)cc1 |
| InChI | InChI=1S/C24H25F3N2/c25-24(26,27)22-8-6-19(7-9-22)17-29-12-10-20(11-13-29)23-16-28-15-21(23)14-18-4-2-1-3-5-18/h1-9,15,20H,10-14,16-17H2 |
| InChIKey | ZBCZRHZHLSJBQR-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |