C19H23NO2 — CID 14947009
2-(3,3-dimethyl-4H-isoquinolin-1-yl)-5,5-dimethylcyclohexane-1,3-dione (PubChem CID 14947009) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 2-(3,3-dimethyl-4H-isoquinolin-1-yl)-5,5-dimethylcyclohexane-1,3-dione.
| Compound Name | 2-(3,3-dimethyl-4H-isoquinolin-1-yl)-5,5-dimethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 14947009 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 2-(3,3-dimethyl-4H-isoquinolin-1-yl)-5,5-dimethylcyclohexane-1,3-dione |
| SMILES | CC1(C)CC(=O)C(C2=NC(C)(C)Cc3ccccc32)C(=O)C1 |
| InChI | InChI=1S/C19H23NO2/c1-18(2)10-14(21)16(15(22)11-18)17-13-8-6-5-7-12(13)9-19(3,4)20-17/h5-8,16H,9-11H2,1-4H3 |
| InChIKey | AWTBJVCXGUKLPZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|