C21H16Br2ClN3O3 — CID 149470768
2-[4-(6,12-dibromo-13-chloro-14-nitroso-4-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-ylidene)piperidin-1-yl]-2-oxoacetaldehyde (PubChem CID 149470768) has the molecular formula C21H16Br2ClN3O3 and a molecular weight of 553.64 g/mol. Its IUPAC name is 2-[4-(6,12-dibromo-13-chloro-14-nitroso-4-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-ylidene)piperidin-1-yl]-2-oxoacetaldehyde.
| Compound Name | 2-[4-(6,12-dibromo-13-chloro-14-nitroso-4-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-ylidene)piperidin-1-yl]-2-oxoacetaldehyde |
|---|---|
| PubChem CID | 149470768 |
| Molecular Formula | C21H16Br2ClN3O3 |
| Molecular Weight | 553.64 g/mol |
| Exact Mass | 550.92 |
| IUPAC Name | 2-[4-(6,12-dibromo-13-chloro-14-nitroso-4-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaen-2-ylidene)piperidin-1-yl]-2-oxoacetaldehyde |
| SMILES | O=CC(=O)N1CCC(=C2c3cc(N=O)c(Cl)c(Br)c3CCc3cc(Br)cnc32)CC1 |
| InChI | InChI=1S/C21H16Br2ClN3O3/c22-13-7-12-1-2-14-15(8-16(26-30)20(24)19(14)23)18(21(12)25-9-13)11-3-5-27(6-4-11)17(29)10-28/h7-10H,1-6H2 |
| InChIKey | ZBHVURGQFXGGFJ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 79.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.64 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|