C15H21N3O2S — CID 14947189
2-(diethylamino)ethyl 2-(1H-benzimidazol-2-ylsulfanyl)acetate (PubChem CID 14947189) has the molecular formula C15H21N3O2S and a molecular weight of 307.42 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 2-(1H-benzimidazol-2-ylsulfanyl)acetate.
| Compound Name | 2-(diethylamino)ethyl 2-(1H-benzimidazol-2-ylsulfanyl)acetate |
|---|---|
| PubChem CID | 14947189 |
| Molecular Formula | C15H21N3O2S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 2-(diethylamino)ethyl 2-(1H-benzimidazol-2-ylsulfanyl)acetate |
| SMILES | CCN(CC)CCOC(=O)CSc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C15H21N3O2S/c1-3-18(4-2)9-10-20-14(19)11-21-15-16-12-7-5-6-8-13(12)17-15/h5-8H,3-4,9-11H2,1-2H3,(H,16,17) |
| InChIKey | URUJMRGPKWCGTD-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |