About 5-benzyl-3H-1,3,4-oxadiazol-2-one
5-benzyl-3H-1,3,4-oxadiazol-2-one (PubChem CID 14947440) has the molecular formula C9H8N2O2
and a molecular weight of 176.18 g/mol. Its IUPAC name is 5-benzyl-3H-1,3,4-oxadiazol-2-one.
Molecular Properties
| Compound Name | 5-benzyl-3H-1,3,4-oxadiazol-2-one |
| PubChem CID | 14947440 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | 5-benzyl-3H-1,3,4-oxadiazol-2-one |
| SMILES | O=c1[nH]nc(Cc2ccccc2)o1 |
| InChI | InChI=1S/C9H8N2O2/c12-9-11-10-8(13-9)6-7-4-2-1-3-5-7/h1-5H,6H2,(H,11,12) |
| InChIKey | QSEALXFPOAYSEI-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-benzyl-3H-1,3,4-oxadiazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyl-3H-1,3,4-oxadiazol-2-one?
The IUPAC name of 5-benzyl-3H-1,3,4-oxadiazol-2-one (CID 14947440) is 5-benzyl-3H-1,3,4-oxadiazol-2-one.
What is the SMILES notation for 5-benzyl-3H-1,3,4-oxadiazol-2-one?
The canonical SMILES for 5-benzyl-3H-1,3,4-oxadiazol-2-one is O=c1[nH]nc(Cc2ccccc2)o1.
What is the InChIKey of 5-benzyl-3H-1,3,4-oxadiazol-2-one?
The InChIKey is QSEALXFPOAYSEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2/c12-9-11-10-8(13-9)6-7-4-2-1-3-5-7/h1-5H,6H2,(H,11,12).
What are the key properties of 5-benzyl-3H-1,3,4-oxadiazol-2-one?
5-benzyl-3H-1,3,4-oxadiazol-2-one has a molecular weight of 176.18 g/mol, XLogP of 0.95, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-3H-1,3,4-oxadiazol-2-one is sourced from PubChem (CID 14947440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).