C11H15NO4 — CID 149475750
2-(7-hydroxy-7-methyl-3-azabicyclo[3.3.1]non-5-en-1-yl)-2-oxoacetic acid (PubChem CID 149475750) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is 2-(7-hydroxy-7-methyl-3-azabicyclo[3.3.1]non-5-en-1-yl)-2-oxoacetic acid.
| Compound Name | 2-(7-hydroxy-7-methyl-3-azabicyclo[3.3.1]non-5-en-1-yl)-2-oxoacetic acid |
|---|---|
| PubChem CID | 149475750 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 2-(7-hydroxy-7-methyl-3-azabicyclo[3.3.1]non-5-en-1-yl)-2-oxoacetic acid |
| SMILES | CC1(O)C=C2CNCC(C(=O)C(=O)O)(C2)C1 |
| InChI | InChI=1S/C11H15NO4/c1-10(16)2-7-3-11(5-10,6-12-4-7)8(13)9(14)15/h2,12,16H,3-6H2,1H3,(H,14,15) |
| InChIKey | ZCGCNECGUIZWTD-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|