About 4-(diethoxymethyl)-1,3-diselenole-2-selone
4-(diethoxymethyl)-1,3-diselenole-2-selone (PubChem CID 14947646) has the molecular formula C8H12O2Se3
and a molecular weight of 377.06 g/mol. Its IUPAC name is 4-(diethoxymethyl)-1,3-diselenole-2-selone.
Molecular Properties
| Compound Name | 4-(diethoxymethyl)-1,3-diselenole-2-selone |
| PubChem CID | 14947646 |
| Molecular Formula | C8H12O2Se3 |
| Molecular Weight | 377.06 g/mol |
| Exact Mass | 379.83 |
| IUPAC Name | 4-(diethoxymethyl)-1,3-diselenole-2-selone |
| SMILES | CCOC(OCC)c1c[se]c(=[Se])[se]1 |
| InChI | InChI=1S/C8H12O2Se3/c1-3-9-7(10-4-2)6-5-12-8(11)13-6/h5,7H,3-4H2,1-2H3 |
| InChIKey | YVNHFKCVBYLQTD-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.06 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-(diethoxymethyl)-1,3-diselenole-2-selone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(diethoxymethyl)-1,3-diselenole-2-selone?
The IUPAC name of 4-(diethoxymethyl)-1,3-diselenole-2-selone (CID 14947646) is 4-(diethoxymethyl)-1,3-diselenole-2-selone.
What is the SMILES notation for 4-(diethoxymethyl)-1,3-diselenole-2-selone?
The canonical SMILES for 4-(diethoxymethyl)-1,3-diselenole-2-selone is CCOC(OCC)c1c[se]c(=[Se])[se]1.
What is the InChIKey of 4-(diethoxymethyl)-1,3-diselenole-2-selone?
The InChIKey is YVNHFKCVBYLQTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O2Se3/c1-3-9-7(10-4-2)6-5-12-8(11)13-6/h5,7H,3-4H2,1-2H3.
What are the key properties of 4-(diethoxymethyl)-1,3-diselenole-2-selone?
4-(diethoxymethyl)-1,3-diselenole-2-selone has a molecular weight of 377.06 g/mol, XLogP of 0.57, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(diethoxymethyl)-1,3-diselenole-2-selone is sourced from PubChem (CID 14947646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).