C33H24F6N4O — CID 149481405
(4R)-1-[9-(difluoromethyl)-5,5-difluoro-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]-5-(3,5-difluorophenyl)-4-(3-isoquinolin-7-yl-2-pyridinyl)pentan-2-one (PubChem CID 149481405) has the molecular formula C33H24F6N4O and a molecular weight of 606.57 g/mol. Its IUPAC name is (4R)-1-[9-(difluoromethyl)-5,5-difluoro-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]-5-(3,5-difluorophenyl)-4-(3-isoquinolin-7-yl-2-pyridinyl)pentan-2-one.
| Compound Name | (4R)-1-[9-(difluoromethyl)-5,5-difluoro-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]-5-(3,5-difluorophenyl)-4-(3-isoquinolin-7-yl-2-pyridinyl)pentan-2-one |
|---|---|
| PubChem CID | 149481405 |
| Molecular Formula | C33H24F6N4O |
| Molecular Weight | 606.57 g/mol |
| Exact Mass | 606.19 |
| IUPAC Name | (4R)-1-[9-(difluoromethyl)-5,5-difluoro-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl]-5-(3,5-difluorophenyl)-4-(3-isoquinolin-7-yl-2-pyridinyl)pentan-2-one |
| SMILES | O=C(C[C@@H](Cc1cc(F)cc(F)c1)c1ncccc1-c1ccc2ccncc2c1)Cn1nc(C(F)F)c2c1C(F)(F)C1CC21 |
| InChI | InChI=1S/C33H24F6N4O/c34-22-9-17(10-23(35)13-22)8-20(29-25(2-1-6-41-29)19-4-3-18-5-7-40-15-21(18)11-19)12-24(44)16-43-31-28(30(42-43)32(36)37)26-14-27(26)33(31,38)39/h1-7,9-11,13,15,20,26-27,32H,8,12,14,16H2/t20-,26?,27?/m1/s1 |
| InChIKey | ZDIFVAHELMVACD-RHKGEPBNSA-N |
| XLogP | 7.90 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.57 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |