C26H36N2O2 — CID 149482854
1-[(6aR)-5-cyclopropyl-10a-hydroxy-4,7-dimethyl-6a,8,9,10-tetrahydro-6H-indolo[4,3-fg]quinolin-9-yl]-3-ethylpentan-1-one (PubChem CID 149482854) has the molecular formula C26H36N2O2 and a molecular weight of 408.59 g/mol. Its IUPAC name is 1-[(6aR)-5-cyclopropyl-10a-hydroxy-4,7-dimethyl-6a,8,9,10-tetrahydro-6H-indolo[4,3-fg]quinolin-9-yl]-3-ethylpentan-1-one.
| Compound Name | 1-[(6aR)-5-cyclopropyl-10a-hydroxy-4,7-dimethyl-6a,8,9,10-tetrahydro-6H-indolo[4,3-fg]quinolin-9-yl]-3-ethylpentan-1-one |
|---|---|
| PubChem CID | 149482854 |
| Molecular Formula | C26H36N2O2 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.28 |
| IUPAC Name | 1-[(6aR)-5-cyclopropyl-10a-hydroxy-4,7-dimethyl-6a,8,9,10-tetrahydro-6H-indolo[4,3-fg]quinolin-9-yl]-3-ethylpentan-1-one |
| SMILES | CCC(CC)CC(=O)C1CN(C)[C@@H]2Cc3c(C4CC4)n(C)c4cccc(c34)C2(O)C1 |
| InChI | InChI=1S/C26H36N2O2/c1-5-16(6-2)12-22(29)18-14-26(30)20-8-7-9-21-24(20)19(13-23(26)27(3)15-18)25(28(21)4)17-10-11-17/h7-9,16-18,23,30H,5-6,10-15H2,1-4H3/t18?,23-,26?/m1/s1 |
| InChIKey | ZDPINQHXNSYYEB-GRELRLAZSA-N |
| XLogP | 4.52 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|