About 2-[(dimethylamino)methyl]propane-1,3-diol
2-[(dimethylamino)methyl]propane-1,3-diol (PubChem CID 14948471) has the molecular formula C6H15NO2
and a molecular weight of 133.19 g/mol. Its IUPAC name is 2-[(dimethylamino)methyl]propane-1,3-diol.
Molecular Properties
| Compound Name | 2-[(dimethylamino)methyl]propane-1,3-diol |
| PubChem CID | 14948471 |
| Molecular Formula | C6H15NO2 |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.11 |
| IUPAC Name | 2-[(dimethylamino)methyl]propane-1,3-diol |
| SMILES | CN(C)CC(CO)CO |
| InChI | InChI=1S/C6H15NO2/c1-7(2)3-6(4-8)5-9/h6,8-9H,3-5H2,1-2H3 |
| InChIKey | KXVPDGDAUFGDRL-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(dimethylamino)methyl]propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(dimethylamino)methyl]propane-1,3-diol?
The IUPAC name of 2-[(dimethylamino)methyl]propane-1,3-diol (CID 14948471) is 2-[(dimethylamino)methyl]propane-1,3-diol.
What is the SMILES notation for 2-[(dimethylamino)methyl]propane-1,3-diol?
The canonical SMILES for 2-[(dimethylamino)methyl]propane-1,3-diol is CN(C)CC(CO)CO.
What is the InChIKey of 2-[(dimethylamino)methyl]propane-1,3-diol?
The InChIKey is KXVPDGDAUFGDRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO2/c1-7(2)3-6(4-8)5-9/h6,8-9H,3-5H2,1-2H3.
What are the key properties of 2-[(dimethylamino)methyl]propane-1,3-diol?
2-[(dimethylamino)methyl]propane-1,3-diol has a molecular weight of 133.19 g/mol, XLogP of -0.85, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(dimethylamino)methyl]propane-1,3-diol is sourced from PubChem (CID 14948471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).