About 2-(6-amino-3-pyridinyl)-4-(1-cyclohexylpyrazol-4-yl)furo[2,3-c]pyridin-7-amine
2-(6-amino-3-pyridinyl)-4-(1-cyclohexylpyrazol-4-yl)furo[2,3-c]pyridin-7-amine (PubChem CID 149486732) has the molecular formula C21H22N6O
and a molecular weight of 374.45 g/mol. Its IUPAC name is 2-(6-amino-3-pyridinyl)-4-(1-cyclohexylpyrazol-4-yl)furo[2,3-c]pyridin-7-amine.
Molecular Properties
| Compound Name | 2-(6-amino-3-pyridinyl)-4-(1-cyclohexylpyrazol-4-yl)furo[2,3-c]pyridin-7-amine |
| PubChem CID | 149486732 |
| Molecular Formula | C21H22N6O |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 2-(6-amino-3-pyridinyl)-4-(1-cyclohexylpyrazol-4-yl)furo[2,3-c]pyridin-7-amine |
| SMILES | Nc1ccc(-c2cc3c(-c4cnn(C5CCCCC5)c4)cnc(N)c3o2)cn1 |
| InChI | InChI=1S/C21H22N6O/c22-19-7-6-13(9-24-19)18-8-16-17(11-25-21(23)20(16)28-18)14-10-26-27(12-14)15-4-2-1-3-5-15/h6-12,15H,1-5H2,(H2,22,24)(H2,23,25) |
| InChIKey | ZEHQAOGJZFTGLB-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 108.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(6-amino-3-pyridinyl)-4-(1-cyclohexylpyrazol-4-yl)furo[2,3-c]pyridin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-amino-3-pyridinyl)-4-(1-cyclohexylpyrazol-4-yl)furo[2,3-c]pyridin-7-amine?
The IUPAC name of 2-(6-amino-3-pyridinyl)-4-(1-cyclohexylpyrazol-4-yl)furo[2,3-c]pyridin-7-amine (CID 149486732) is 2-(6-amino-3-pyridinyl)-4-(1-cyclohexylpyrazol-4-yl)furo[2,3-c]pyridin-7-amine.
What is the SMILES notation for 2-(6-amino-3-pyridinyl)-4-(1-cyclohexylpyrazol-4-yl)furo[2,3-c]pyridin-7-amine?
The canonical SMILES for 2-(6-amino-3-pyridinyl)-4-(1-cyclohexylpyrazol-4-yl)furo[2,3-c]pyridin-7-amine is Nc1ccc(-c2cc3c(-c4cnn(C5CCCCC5)c4)cnc(N)c3o2)cn1.
What is the InChIKey of 2-(6-amino-3-pyridinyl)-4-(1-cyclohexylpyrazol-4-yl)furo[2,3-c]pyridin-7-amine?
The InChIKey is ZEHQAOGJZFTGLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N6O/c22-19-7-6-13(9-24-19)18-8-16-17(11-25-21(23)20(16)28-18)14-10-26-27(12-14)15-4-2-1-3-5-15/h6-12,15H,1-5H2,(H2,22,24)(H2,23,25).
What are the key properties of 2-(6-amino-3-pyridinyl)-4-(1-cyclohexylpyrazol-4-yl)furo[2,3-c]pyridin-7-amine?
2-(6-amino-3-pyridinyl)-4-(1-cyclohexylpyrazol-4-yl)furo[2,3-c]pyridin-7-amine has a molecular weight of 374.45 g/mol, XLogP of 4.42, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-amino-3-pyridinyl)-4-(1-cyclohexylpyrazol-4-yl)furo[2,3-c]pyridin-7-amine is sourced from PubChem (CID 149486732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).