About 5-amino-4-[(2,6-dichlorophenyl)diazenyl]-1,2-dihydropyrazol-3-one
5-amino-4-[(2,6-dichlorophenyl)diazenyl]-1,2-dihydropyrazol-3-one (PubChem CID 1494874) has the molecular formula C9H7Cl2N5O
and a molecular weight of 272.09 g/mol. Its IUPAC name is 5-amino-4-[(2,6-dichlorophenyl)diazenyl]-1,2-dihydropyrazol-3-one.
Molecular Properties
| Compound Name | 5-amino-4-[(2,6-dichlorophenyl)diazenyl]-1,2-dihydropyrazol-3-one |
| PubChem CID | 1494874 |
| Molecular Formula | C9H7Cl2N5O |
| Molecular Weight | 272.09 g/mol |
| Exact Mass | 271.00 |
| IUPAC Name | 5-amino-4-[(2,6-dichlorophenyl)diazenyl]-1,2-dihydropyrazol-3-one |
| SMILES | Nc1[nH][nH]c(=O)c1/N=N/c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C9H7Cl2N5O/c10-4-2-1-3-5(11)6(4)13-14-7-8(12)15-16-9(7)17/h1-3H,(H4,12,15,16,17)/b14-13+ |
| InChIKey | DBPPBMHUOAYPEA-BUHFOSPRSA-N |
| XLogP | 3.01 |
| TPSA | 99.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.09 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-4-[(2,6-dichlorophenyl)diazenyl]-1,2-dihydropyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-4-[(2,6-dichlorophenyl)diazenyl]-1,2-dihydropyrazol-3-one?
The IUPAC name of 5-amino-4-[(2,6-dichlorophenyl)diazenyl]-1,2-dihydropyrazol-3-one (CID 1494874) is 5-amino-4-[(2,6-dichlorophenyl)diazenyl]-1,2-dihydropyrazol-3-one.
What is the SMILES notation for 5-amino-4-[(2,6-dichlorophenyl)diazenyl]-1,2-dihydropyrazol-3-one?
The canonical SMILES for 5-amino-4-[(2,6-dichlorophenyl)diazenyl]-1,2-dihydropyrazol-3-one is Nc1[nH][nH]c(=O)c1/N=N/c1c(Cl)cccc1Cl.
What is the InChIKey of 5-amino-4-[(2,6-dichlorophenyl)diazenyl]-1,2-dihydropyrazol-3-one?
The InChIKey is DBPPBMHUOAYPEA-BUHFOSPRSA-N. The full InChI is InChI=1S/C9H7Cl2N5O/c10-4-2-1-3-5(11)6(4)13-14-7-8(12)15-16-9(7)17/h1-3H,(H4,12,15,16,17)/b14-13+.
What are the key properties of 5-amino-4-[(2,6-dichlorophenyl)diazenyl]-1,2-dihydropyrazol-3-one?
5-amino-4-[(2,6-dichlorophenyl)diazenyl]-1,2-dihydropyrazol-3-one has a molecular weight of 272.09 g/mol, XLogP of 3.01, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-4-[(2,6-dichlorophenyl)diazenyl]-1,2-dihydropyrazol-3-one is sourced from PubChem (CID 1494874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).