About 5-amino-4-[(2,3-dichlorophenyl)diazenyl]-2-methyl-1H-pyrazol-3-one
5-amino-4-[(2,3-dichlorophenyl)diazenyl]-2-methyl-1H-pyrazol-3-one (PubChem CID 1494891) has the molecular formula C10H9Cl2N5O
and a molecular weight of 286.12 g/mol. Its IUPAC name is 5-amino-4-[(2,3-dichlorophenyl)diazenyl]-2-methyl-1H-pyrazol-3-one.
Molecular Properties
| Compound Name | 5-amino-4-[(2,3-dichlorophenyl)diazenyl]-2-methyl-1H-pyrazol-3-one |
| PubChem CID | 1494891 |
| Molecular Formula | C10H9Cl2N5O |
| Molecular Weight | 286.12 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | 5-amino-4-[(2,3-dichlorophenyl)diazenyl]-2-methyl-1H-pyrazol-3-one |
| SMILES | Cn1[nH]c(N)c(/N=N/c2cccc(Cl)c2Cl)c1=O |
| InChI | InChI=1S/C10H9Cl2N5O/c1-17-10(18)8(9(13)16-17)15-14-6-4-2-3-5(11)7(6)12/h2-4,16H,13H2,1H3/b15-14+ |
| InChIKey | MCFNFHFIONYPRC-CCEZHUSRSA-N |
| XLogP | 3.02 |
| TPSA | 88.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.12 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-4-[(2,3-dichlorophenyl)diazenyl]-2-methyl-1H-pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-4-[(2,3-dichlorophenyl)diazenyl]-2-methyl-1H-pyrazol-3-one?
The IUPAC name of 5-amino-4-[(2,3-dichlorophenyl)diazenyl]-2-methyl-1H-pyrazol-3-one (CID 1494891) is 5-amino-4-[(2,3-dichlorophenyl)diazenyl]-2-methyl-1H-pyrazol-3-one.
What is the SMILES notation for 5-amino-4-[(2,3-dichlorophenyl)diazenyl]-2-methyl-1H-pyrazol-3-one?
The canonical SMILES for 5-amino-4-[(2,3-dichlorophenyl)diazenyl]-2-methyl-1H-pyrazol-3-one is Cn1[nH]c(N)c(/N=N/c2cccc(Cl)c2Cl)c1=O.
What is the InChIKey of 5-amino-4-[(2,3-dichlorophenyl)diazenyl]-2-methyl-1H-pyrazol-3-one?
The InChIKey is MCFNFHFIONYPRC-CCEZHUSRSA-N. The full InChI is InChI=1S/C10H9Cl2N5O/c1-17-10(18)8(9(13)16-17)15-14-6-4-2-3-5(11)7(6)12/h2-4,16H,13H2,1H3/b15-14+.
What are the key properties of 5-amino-4-[(2,3-dichlorophenyl)diazenyl]-2-methyl-1H-pyrazol-3-one?
5-amino-4-[(2,3-dichlorophenyl)diazenyl]-2-methyl-1H-pyrazol-3-one has a molecular weight of 286.12 g/mol, XLogP of 3.02, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-4-[(2,3-dichlorophenyl)diazenyl]-2-methyl-1H-pyrazol-3-one is sourced from PubChem (CID 1494891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).