C14H16O5Si2 — CID 14949094
3,5-bis(ethenyl)-3,5-dimethyl-2,4,6,3,5-benzotrioxadisilonine-1,7-dione (PubChem CID 14949094) has the molecular formula C14H16O5Si2 and a molecular weight of 320.45 g/mol. Its IUPAC name is 3,5-bis(ethenyl)-3,5-dimethyl-2,4,6,3,5-benzotrioxadisilonine-1,7-dione.
| Compound Name | 3,5-bis(ethenyl)-3,5-dimethyl-2,4,6,3,5-benzotrioxadisilonine-1,7-dione |
|---|---|
| PubChem CID | 14949094 |
| Molecular Formula | C14H16O5Si2 |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 3,5-bis(ethenyl)-3,5-dimethyl-2,4,6,3,5-benzotrioxadisilonine-1,7-dione |
| SMILES | C=C[Si]1(C)OC(=O)c2ccccc2C(=O)O[Si](C)(C=C)O1 |
| InChI | InChI=1S/C14H16O5Si2/c1-5-20(3)17-13(15)11-9-7-8-10-12(11)14(16)18-21(4,6-2)19-20/h5-10H,1-2H2,3-4H3 |
| InChIKey | QUVVKUZHTWLHEH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|