About 3,3-dimethylpyrrolidine
3,3-dimethylpyrrolidine (PubChem CID 14949211) has the molecular formula C6H13N
and a molecular weight of 99.18 g/mol. Its IUPAC name is 3,3-dimethylpyrrolidine.
Molecular Properties
| Compound Name | 3,3-dimethylpyrrolidine |
| PubChem CID | 14949211 |
| Molecular Formula | C6H13N |
| Molecular Weight | 99.18 g/mol |
| Exact Mass | 99.10 |
| IUPAC Name | 3,3-dimethylpyrrolidine |
| SMILES | CC1(C)CCNC1 |
| InChI | InChI=1S/C6H13N/c1-6(2)3-4-7-5-6/h7H,3-5H2,1-2H3 |
| InChIKey | XBQNZPDIRJPFAI-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.18 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,3-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethylpyrrolidine?
The IUPAC name of 3,3-dimethylpyrrolidine (CID 14949211) is 3,3-dimethylpyrrolidine.
What is the SMILES notation for 3,3-dimethylpyrrolidine?
The canonical SMILES for 3,3-dimethylpyrrolidine is CC1(C)CCNC1.
What is the InChIKey of 3,3-dimethylpyrrolidine?
The InChIKey is XBQNZPDIRJPFAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N/c1-6(2)3-4-7-5-6/h7H,3-5H2,1-2H3.
What are the key properties of 3,3-dimethylpyrrolidine?
3,3-dimethylpyrrolidine has a molecular weight of 99.18 g/mol, XLogP of 1.01, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethylpyrrolidine is sourced from PubChem (CID 14949211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).