About 3-methyl-2-phenylimino-1,3-thiazolidin-4-one
3-methyl-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 1494947) has the molecular formula C10H10N2OS
and a molecular weight of 206.27 g/mol. Its IUPAC name is 3-methyl-2-phenylimino-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 3-methyl-2-phenylimino-1,3-thiazolidin-4-one |
| PubChem CID | 1494947 |
| Molecular Formula | C10H10N2OS |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 3-methyl-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | CN1C(=O)CS/C1=N\c1ccccc1 |
| InChI | InChI=1S/C10H10N2OS/c1-12-9(13)7-14-10(12)11-8-5-3-2-4-6-8/h2-6H,7H2,1H3/b11-10- |
| InChIKey | SOXGCENCQVQSJB-KHPPLWFESA-N |
| XLogP | 1.88 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-2-phenylimino-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-phenylimino-1,3-thiazolidin-4-one?
The IUPAC name of 3-methyl-2-phenylimino-1,3-thiazolidin-4-one (CID 1494947) is 3-methyl-2-phenylimino-1,3-thiazolidin-4-one.
What is the SMILES notation for 3-methyl-2-phenylimino-1,3-thiazolidin-4-one?
The canonical SMILES for 3-methyl-2-phenylimino-1,3-thiazolidin-4-one is CN1C(=O)CS/C1=N\c1ccccc1.
What is the InChIKey of 3-methyl-2-phenylimino-1,3-thiazolidin-4-one?
The InChIKey is SOXGCENCQVQSJB-KHPPLWFESA-N. The full InChI is InChI=1S/C10H10N2OS/c1-12-9(13)7-14-10(12)11-8-5-3-2-4-6-8/h2-6H,7H2,1H3/b11-10-.
What are the key properties of 3-methyl-2-phenylimino-1,3-thiazolidin-4-one?
3-methyl-2-phenylimino-1,3-thiazolidin-4-one has a molecular weight of 206.27 g/mol, XLogP of 1.88, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-phenylimino-1,3-thiazolidin-4-one is sourced from PubChem (CID 1494947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).