C13H26B2O4 — CID 149497607
5,5,6,6-tetramethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,4,2-dioxaborinane (PubChem CID 149497607) has the molecular formula C13H26B2O4 and a molecular weight of 267.97 g/mol. Its IUPAC name is 5,5,6,6-tetramethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,4,2-dioxaborinane.
| Compound Name | 5,5,6,6-tetramethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,4,2-dioxaborinane |
|---|---|
| PubChem CID | 149497607 |
| Molecular Formula | C13H26B2O4 |
| Molecular Weight | 267.97 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 5,5,6,6-tetramethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,4,2-dioxaborinane |
| SMILES | CC1(C)OCB(B2OC(C)(C)C(C)(C)O2)OC1(C)C |
| InChI | InChI=1S/C13H26B2O4/c1-10(2)11(3,4)17-14(9-16-10)15-18-12(5,6)13(7,8)19-15/h9H2,1-8H3 |
| InChIKey | ZGIVLAJPKYYMFW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.97 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|