C23H34N6OS — CID 149499159
5-[4-(1-amino-3-methyliminoprop-1-en-2-yl)-2-methoxyphenyl]-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,4-thiadiazol-2-amine (PubChem CID 149499159) has the molecular formula C23H34N6OS and a molecular weight of 442.63 g/mol. Its IUPAC name is 5-[4-(1-amino-3-methyliminoprop-1-en-2-yl)-2-methoxyphenyl]-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[4-(1-amino-3-methyliminoprop-1-en-2-yl)-2-methoxyphenyl]-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 149499159 |
| Molecular Formula | C23H34N6OS |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.25 |
| IUPAC Name | 5-[4-(1-amino-3-methyliminoprop-1-en-2-yl)-2-methoxyphenyl]-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,4-thiadiazol-2-amine |
| SMILES | C/N=C/C(=CN)c1ccc(-c2nnc(N(C)C3CC(C)(C)NC(C)(C)C3)s2)c(OC)c1 |
| InChI | InChI=1S/C23H34N6OS/c1-22(2)11-17(12-23(3,4)28-22)29(6)21-27-26-20(31-21)18-9-8-15(10-19(18)30-7)16(13-24)14-25-5/h8-10,13-14,17,28H,11-12,24H2,1-7H3/b16-13?,25-14+ |
| InChIKey | DLQZZUYZBSPESM-BZMPBLHCSA-N |
| XLogP | 3.96 |
| TPSA | 88.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|