C9H11NO5S2 — CID 14950175
6-methoxy-1,1-dioxo-2,3-dihydro-1-benzothiophene-2-sulfonamide (PubChem CID 14950175) has the molecular formula C9H11NO5S2 and a molecular weight of 277.32 g/mol. Its IUPAC name is 6-methoxy-1,1-dioxo-2,3-dihydro-1-benzothiophene-2-sulfonamide.
| Compound Name | 6-methoxy-1,1-dioxo-2,3-dihydro-1-benzothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 14950175 |
| Molecular Formula | C9H11NO5S2 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | 6-methoxy-1,1-dioxo-2,3-dihydro-1-benzothiophene-2-sulfonamide |
| SMILES | COc1ccc2c(c1)S(=O)(=O)C(S(N)(=O)=O)C2 |
| InChI | InChI=1S/C9H11NO5S2/c1-15-7-3-2-6-4-9(17(10,13)14)16(11,12)8(6)5-7/h2-3,5,9H,4H2,1H3,(H2,10,13,14) |
| InChIKey | LIWNBMPRVXWOTF-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |