C13H11BrN2OS — CID 14950685
(2Z)-2-[(4-bromophenyl)methylidene]-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazin-3-one (PubChem CID 14950685) has the molecular formula C13H11BrN2OS and a molecular weight of 323.22 g/mol. Its IUPAC name is (2Z)-2-[(4-bromophenyl)methylidene]-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazin-3-one.
| Compound Name | (2Z)-2-[(4-bromophenyl)methylidene]-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazin-3-one |
|---|---|
| PubChem CID | 14950685 |
| Molecular Formula | C13H11BrN2OS |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 321.98 |
| IUPAC Name | (2Z)-2-[(4-bromophenyl)methylidene]-6,7-dihydro-5H-imidazo[2,1-b][1,3]thiazin-3-one |
| SMILES | O=C1/C(=C/c2ccc(Br)cc2)N=C2SCCCN12 |
| InChI | InChI=1S/C13H11BrN2OS/c14-10-4-2-9(3-5-10)8-11-12(17)16-6-1-7-18-13(16)15-11/h2-5,8H,1,6-7H2/b11-8- |
| InChIKey | CDHVKCLNVBLBCF-FLIBITNWSA-N |
| XLogP | 3.13 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|