C31H41N7O2 — CID 14950923
6-[4-[[2-(3,5-dimethoxyphenyl)-2-(2-methylphenyl)ethyl]amino]piperidin-1-yl]-2-N,4-N-bis(prop-2-enyl)-1,3,5-triazine-2,4-diamine (PubChem CID 14950923) has the molecular formula C31H41N7O2 and a molecular weight of 543.72 g/mol. Its IUPAC name is 6-[4-[[2-(3,5-dimethoxyphenyl)-2-(2-methylphenyl)ethyl]amino]piperidin-1-yl]-2-N,4-N-bis(prop-2-enyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[4-[[2-(3,5-dimethoxyphenyl)-2-(2-methylphenyl)ethyl]amino]piperidin-1-yl]-2-N,4-N-bis(prop-2-enyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 14950923 |
| Molecular Formula | C31H41N7O2 |
| Molecular Weight | 543.72 g/mol |
| Exact Mass | 543.33 |
| IUPAC Name | 6-[4-[[2-(3,5-dimethoxyphenyl)-2-(2-methylphenyl)ethyl]amino]piperidin-1-yl]-2-N,4-N-bis(prop-2-enyl)-1,3,5-triazine-2,4-diamine |
| SMILES | C=CCNc1nc(NCC=C)nc(N2CCC(NCC(c3cc(OC)cc(OC)c3)c3ccccc3C)CC2)n1 |
| InChI | InChI=1S/C31H41N7O2/c1-6-14-32-29-35-30(33-15-7-2)37-31(36-29)38-16-12-24(13-17-38)34-21-28(27-11-9-8-10-22(27)3)23-18-25(39-4)20-26(19-23)40-5/h6-11,18-20,24,28,34H,1-2,12-17,21H2,3-5H3,(H2,32,33,35,36,37) |
| InChIKey | OQELTDNRIOSQGM-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 96.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.72 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|