C29H35N7 — CID 14950941
2-N,4-N-bis(prop-2-enyl)-6-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylamino)piperidin-1-yl]-1,3,5-triazine-2,4-diamine (PubChem CID 14950941) has the molecular formula C29H35N7 and a molecular weight of 481.65 g/mol. Its IUPAC name is 2-N,4-N-bis(prop-2-enyl)-6-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylamino)piperidin-1-yl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-bis(prop-2-enyl)-6-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylamino)piperidin-1-yl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 14950941 |
| Molecular Formula | C29H35N7 |
| Molecular Weight | 481.65 g/mol |
| Exact Mass | 481.30 |
| IUPAC Name | 2-N,4-N-bis(prop-2-enyl)-6-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylamino)piperidin-1-yl]-1,3,5-triazine-2,4-diamine |
| SMILES | C=CCNc1nc(NCC=C)nc(N2CCC(NC3c4ccccc4CCc4ccccc43)CC2)n1 |
| InChI | InChI=1S/C29H35N7/c1-3-17-30-27-33-28(31-18-4-2)35-29(34-27)36-19-15-23(16-20-36)32-26-24-11-7-5-9-21(24)13-14-22-10-6-8-12-25(22)26/h3-12,23,26,32H,1-2,13-20H2,(H2,30,31,33,34,35) |
| InChIKey | UDFNASCXFITTGE-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 78.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.65 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|