C31H39N7 — CID 14950950
2-N,4-N-bis(prop-2-enyl)-6-[4-(2-tricyclo[10.4.0.03,8]hexadeca-1(16),3,5,7,12,14-hexaenylmethylamino)piperidin-1-yl]-1,3,5-triazine-2,4-diamine (PubChem CID 14950950) has the molecular formula C31H39N7 and a molecular weight of 509.70 g/mol. Its IUPAC name is 2-N,4-N-bis(prop-2-enyl)-6-[4-(2-tricyclo[10.4.0.03,8]hexadeca-1(16),3,5,7,12,14-hexaenylmethylamino)piperidin-1-yl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-bis(prop-2-enyl)-6-[4-(2-tricyclo[10.4.0.03,8]hexadeca-1(16),3,5,7,12,14-hexaenylmethylamino)piperidin-1-yl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 14950950 |
| Molecular Formula | C31H39N7 |
| Molecular Weight | 509.70 g/mol |
| Exact Mass | 509.33 |
| IUPAC Name | 2-N,4-N-bis(prop-2-enyl)-6-[4-(2-tricyclo[10.4.0.03,8]hexadeca-1(16),3,5,7,12,14-hexaenylmethylamino)piperidin-1-yl]-1,3,5-triazine-2,4-diamine |
| SMILES | C=CCNc1nc(NCC=C)nc(N2CCC(NCC3c4ccccc4CCCc4ccccc43)CC2)n1 |
| InChI | InChI=1S/C31H39N7/c1-3-18-32-29-35-30(33-19-4-2)37-31(36-29)38-20-16-25(17-21-38)34-22-28-26-14-7-5-10-23(26)12-9-13-24-11-6-8-15-27(24)28/h3-8,10-11,14-15,25,28,34H,1-2,9,12-13,16-22H2,(H2,32,33,35,36,37) |
| InChIKey | NQOMOISMLLUNBH-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 78.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.70 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|