C31H39N7O — CID 14950961
6-[4-[(6-methoxy-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)methylamino]piperidin-1-yl]-2-N,4-N-bis(prop-2-enyl)-1,3,5-triazine-2,4-diamine (PubChem CID 14950961) has the molecular formula C31H39N7O and a molecular weight of 525.70 g/mol. Its IUPAC name is 6-[4-[(6-methoxy-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)methylamino]piperidin-1-yl]-2-N,4-N-bis(prop-2-enyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[4-[(6-methoxy-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)methylamino]piperidin-1-yl]-2-N,4-N-bis(prop-2-enyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 14950961 |
| Molecular Formula | C31H39N7O |
| Molecular Weight | 525.70 g/mol |
| Exact Mass | 525.32 |
| IUPAC Name | 6-[4-[(6-methoxy-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)methylamino]piperidin-1-yl]-2-N,4-N-bis(prop-2-enyl)-1,3,5-triazine-2,4-diamine |
| SMILES | C=CCNc1nc(NCC=C)nc(N2CCC(NCC3c4ccccc4CCc4cc(OC)ccc43)CC2)n1 |
| InChI | InChI=1S/C31H39N7O/c1-4-16-32-29-35-30(33-17-5-2)37-31(36-29)38-18-14-24(15-19-38)34-21-28-26-9-7-6-8-22(26)10-11-23-20-25(39-3)12-13-27(23)28/h4-9,12-13,20,24,28,34H,1-2,10-11,14-19,21H2,3H3,(H2,32,33,35,36,37) |
| InChIKey | DHFUTAASXVSVFF-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 87.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.70 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|