C31H40N8 — CID 14950968
2-N,4-N-bis(prop-2-enyl)-6-N-[2-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylamino)piperidin-1-yl]ethyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 14950968) has the molecular formula C31H40N8 and a molecular weight of 524.72 g/mol. Its IUPAC name is 2-N,4-N-bis(prop-2-enyl)-6-N-[2-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylamino)piperidin-1-yl]ethyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N-bis(prop-2-enyl)-6-N-[2-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylamino)piperidin-1-yl]ethyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 14950968 |
| Molecular Formula | C31H40N8 |
| Molecular Weight | 524.72 g/mol |
| Exact Mass | 524.34 |
| IUPAC Name | 2-N,4-N-bis(prop-2-enyl)-6-N-[2-[4-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,11,13-hexaenylamino)piperidin-1-yl]ethyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | C=CCNc1nc(NCC=C)nc(NCCN2CCC(NC3c4ccccc4CCc4ccccc43)CC2)n1 |
| InChI | InChI=1S/C31H40N8/c1-3-17-32-29-36-30(33-18-4-2)38-31(37-29)34-19-22-39-20-15-25(16-21-39)35-28-26-11-7-5-9-23(26)13-14-24-10-6-8-12-27(24)28/h3-12,25,28,35H,1-2,13-22H2,(H3,32,33,34,36,37,38) |
| InChIKey | QYXCOVUNFPACJM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.72 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|