C25H23N5S — CID 14950980
1-(5,6-diphenyl-1,2,4-triazin-3-yl)-2-[(E)-3-phenylsulfanylbut-1-enyl]hydrazine (PubChem CID 14950980) has the molecular formula C25H23N5S and a molecular weight of 425.56 g/mol. Its IUPAC name is 1-(5,6-diphenyl-1,2,4-triazin-3-yl)-2-[(E)-3-phenylsulfanylbut-1-enyl]hydrazine.
| Compound Name | 1-(5,6-diphenyl-1,2,4-triazin-3-yl)-2-[(E)-3-phenylsulfanylbut-1-enyl]hydrazine |
|---|---|
| PubChem CID | 14950980 |
| Molecular Formula | C25H23N5S |
| Molecular Weight | 425.56 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 1-(5,6-diphenyl-1,2,4-triazin-3-yl)-2-[(E)-3-phenylsulfanylbut-1-enyl]hydrazine |
| SMILES | CC(/C=C/NNc1nnc(-c2ccccc2)c(-c2ccccc2)n1)Sc1ccccc1 |
| InChI | InChI=1S/C25H23N5S/c1-19(31-22-15-9-4-10-16-22)17-18-26-29-25-27-23(20-11-5-2-6-12-20)24(28-30-25)21-13-7-3-8-14-21/h2-19,26H,1H3,(H,27,29,30)/b18-17+ |
| InChIKey | CPKZRGCASWJQEE-ISLYRVAYSA-N |
| XLogP | 5.82 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.56 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|