C10H8Cl2N4O3S — CID 14951685
(N-(4,6-dichloro-1,3,5-triazin-2-yl)anilino)methanesulfonic acid (PubChem CID 14951685) has the molecular formula C10H8Cl2N4O3S and a molecular weight of 335.17 g/mol. Its IUPAC name is (N-(4,6-dichloro-1,3,5-triazin-2-yl)anilino)methanesulfonic acid.
| Compound Name | (N-(4,6-dichloro-1,3,5-triazin-2-yl)anilino)methanesulfonic acid |
|---|---|
| PubChem CID | 14951685 |
| Molecular Formula | C10H8Cl2N4O3S |
| Molecular Weight | 335.17 g/mol |
| Exact Mass | 333.97 |
| IUPAC Name | (N-(4,6-dichloro-1,3,5-triazin-2-yl)anilino)methanesulfonic acid |
| SMILES | O=S(=O)(O)CN(c1ccccc1)c1nc(Cl)nc(Cl)n1 |
| InChI | InChI=1S/C10H8Cl2N4O3S/c11-8-13-9(12)15-10(14-8)16(6-20(17,18)19)7-4-2-1-3-5-7/h1-5H,6H2,(H,17,18,19) |
| InChIKey | HDWOZTJONKQRMD-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.17 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|