About methyl 2-methoxyoctanoate
methyl 2-methoxyoctanoate (PubChem CID 14952079) has the molecular formula C10H20O3
and a molecular weight of 188.27 g/mol. Its IUPAC name is methyl 2-methoxyoctanoate.
Molecular Properties
| Compound Name | methyl 2-methoxyoctanoate |
| PubChem CID | 14952079 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | methyl 2-methoxyoctanoate |
| SMILES | CCCCCCC(OC)C(=O)OC |
| InChI | InChI=1S/C10H20O3/c1-4-5-6-7-8-9(12-2)10(11)13-3/h9H,4-8H2,1-3H3 |
| InChIKey | GOSKKPRIJXTJAA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-methoxyoctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methoxyoctanoate?
The IUPAC name of methyl 2-methoxyoctanoate (CID 14952079) is methyl 2-methoxyoctanoate.
What is the SMILES notation for methyl 2-methoxyoctanoate?
The canonical SMILES for methyl 2-methoxyoctanoate is CCCCCCC(OC)C(=O)OC.
What is the InChIKey of methyl 2-methoxyoctanoate?
The InChIKey is GOSKKPRIJXTJAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O3/c1-4-5-6-7-8-9(12-2)10(11)13-3/h9H,4-8H2,1-3H3.
What are the key properties of methyl 2-methoxyoctanoate?
methyl 2-methoxyoctanoate has a molecular weight of 188.27 g/mol, XLogP of 2.14, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methoxyoctanoate is sourced from PubChem (CID 14952079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).