About S-benzamido benzenecarbothioate
S-benzamido benzenecarbothioate (PubChem CID 14952493) has the molecular formula C14H11NO2S
and a molecular weight of 257.31 g/mol. Its IUPAC name is S-benzamido benzenecarbothioate.
Molecular Properties
| Compound Name | S-benzamido benzenecarbothioate |
| PubChem CID | 14952493 |
| Molecular Formula | C14H11NO2S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | S-benzamido benzenecarbothioate |
| SMILES | O=C(NSC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H11NO2S/c16-13(11-7-3-1-4-8-11)15-18-14(17)12-9-5-2-6-10-12/h1-10H,(H,15,16) |
| InChIKey | IJYATHJDICJZLJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-benzamido benzenecarbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-benzamido benzenecarbothioate?
The IUPAC name of S-benzamido benzenecarbothioate (CID 14952493) is S-benzamido benzenecarbothioate.
What is the SMILES notation for S-benzamido benzenecarbothioate?
The canonical SMILES for S-benzamido benzenecarbothioate is O=C(NSC(=O)c1ccccc1)c1ccccc1.
What is the InChIKey of S-benzamido benzenecarbothioate?
The InChIKey is IJYATHJDICJZLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO2S/c16-13(11-7-3-1-4-8-11)15-18-14(17)12-9-5-2-6-10-12/h1-10H,(H,15,16).
What are the key properties of S-benzamido benzenecarbothioate?
S-benzamido benzenecarbothioate has a molecular weight of 257.31 g/mol, XLogP of 2.90, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-benzamido benzenecarbothioate is sourced from PubChem (CID 14952493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).