About 1-bromo-2,2,6,6-tetramethylpiperidin-4-one
1-bromo-2,2,6,6-tetramethylpiperidin-4-one (PubChem CID 14952692) has the molecular formula C9H16BrNO
and a molecular weight of 234.14 g/mol. Its IUPAC name is 1-bromo-2,2,6,6-tetramethylpiperidin-4-one.
Molecular Properties
| Compound Name | 1-bromo-2,2,6,6-tetramethylpiperidin-4-one |
| PubChem CID | 14952692 |
| Molecular Formula | C9H16BrNO |
| Molecular Weight | 234.14 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | 1-bromo-2,2,6,6-tetramethylpiperidin-4-one |
| SMILES | CC1(C)CC(=O)CC(C)(C)N1Br |
| InChI | InChI=1S/C9H16BrNO/c1-8(2)5-7(12)6-9(3,4)11(8)10/h5-6H2,1-4H3 |
| InChIKey | ZFJJNLBIHDSWQC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.14 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2,2,6,6-tetramethylpiperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2,2,6,6-tetramethylpiperidin-4-one?
The IUPAC name of 1-bromo-2,2,6,6-tetramethylpiperidin-4-one (CID 14952692) is 1-bromo-2,2,6,6-tetramethylpiperidin-4-one.
What is the SMILES notation for 1-bromo-2,2,6,6-tetramethylpiperidin-4-one?
The canonical SMILES for 1-bromo-2,2,6,6-tetramethylpiperidin-4-one is CC1(C)CC(=O)CC(C)(C)N1Br.
What is the InChIKey of 1-bromo-2,2,6,6-tetramethylpiperidin-4-one?
The InChIKey is ZFJJNLBIHDSWQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16BrNO/c1-8(2)5-7(12)6-9(3,4)11(8)10/h5-6H2,1-4H3.
What are the key properties of 1-bromo-2,2,6,6-tetramethylpiperidin-4-one?
1-bromo-2,2,6,6-tetramethylpiperidin-4-one has a molecular weight of 234.14 g/mol, XLogP of 2.52, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2,2,6,6-tetramethylpiperidin-4-one is sourced from PubChem (CID 14952692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).