About ethyl 4-[5-fluoro-1-[(4-methylsulfanylphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoate
ethyl 4-[5-fluoro-1-[(4-methylsulfanylphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoate (PubChem CID 14953025) has the molecular formula C23H27FN2O2S
and a molecular weight of 414.55 g/mol. Its IUPAC name is ethyl 4-[5-fluoro-1-[(4-methylsulfanylphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoate.
Molecular Properties
| Compound Name | ethyl 4-[5-fluoro-1-[(4-methylsulfanylphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoate |
| PubChem CID | 14953025 |
| Molecular Formula | C23H27FN2O2S |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | ethyl 4-[5-fluoro-1-[(4-methylsulfanylphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoate |
| SMILES | CCOC(=O)CC(C)(C)Cc1nc2cc(F)ccc2n1Cc1ccc(SC)cc1 |
| InChI | InChI=1S/C23H27FN2O2S/c1-5-28-22(27)14-23(2,3)13-21-25-19-12-17(24)8-11-20(19)26(21)15-16-6-9-18(29-4)10-7-16/h6-12H,5,13-15H2,1-4H3 |
| InChIKey | JKFNIUOFQPFEMT-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 4-[5-fluoro-1-[(4-methylsulfanylphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[5-fluoro-1-[(4-methylsulfanylphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoate?
The IUPAC name of ethyl 4-[5-fluoro-1-[(4-methylsulfanylphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoate (CID 14953025) is ethyl 4-[5-fluoro-1-[(4-methylsulfanylphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoate.
What is the SMILES notation for ethyl 4-[5-fluoro-1-[(4-methylsulfanylphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoate?
The canonical SMILES for ethyl 4-[5-fluoro-1-[(4-methylsulfanylphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoate is CCOC(=O)CC(C)(C)Cc1nc2cc(F)ccc2n1Cc1ccc(SC)cc1.
What is the InChIKey of ethyl 4-[5-fluoro-1-[(4-methylsulfanylphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoate?
The InChIKey is JKFNIUOFQPFEMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27FN2O2S/c1-5-28-22(27)14-23(2,3)13-21-25-19-12-17(24)8-11-20(19)26(21)15-16-6-9-18(29-4)10-7-16/h6-12H,5,13-15H2,1-4H3.
What are the key properties of ethyl 4-[5-fluoro-1-[(4-methylsulfanylphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoate?
ethyl 4-[5-fluoro-1-[(4-methylsulfanylphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoate has a molecular weight of 414.55 g/mol, XLogP of 5.47, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[5-fluoro-1-[(4-methylsulfanylphenyl)methyl]benzimidazol-2-yl]-3,3-dimethylbutanoate is sourced from PubChem (CID 14953025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).